Compound Q&A

How is 6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 749849-14-7) typically synthesized?

Answer

6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid
6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid is typically synthesized via a multistep process involving the preparation of the imidazo[1,2-a]pyridine ring followed by bromination and carboxylation. Common catalysts include Lewis acids or Brønsted acids, and the reaction conditions should be carefully controlled to ensure high yield and selectivity.

About

English Name 6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES C1=CC2=NC(=CN2C=C1Br)C(=O)O
InChIKey FQBFPVLZLNEQOE-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 749849-14-7)?

6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid is a solid at room temperature, with a molecular wei...

Compound Q&A

What industries use 6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 749849-14-7)?

6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid is used in the pharmaceutical industry as a precurso...

Compound Q&A

What precautions should be taken when handling 6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 749849-14-7)?

When handling 6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid, it is important to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...