Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2)?

Answer

2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate
When handling 2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, lab coat, and safety goggles. This compound should be stored in a cool, dry place and away from strong acids and bases. Fume hoods should be used during handling to minimize exposure. Always refer to the Safety Data Sheet (SDS) for specific handling and disposal guidelines.

About

English Name 2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate
Molecular Formula C11H17N3O2
Molecular Weight 223.28 g/mol
SMILES CC(C)(C)OC(=O)NC1=NC=C(C=C1)CN
InChIKey DFLQTVPEIMTXSZ-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2)?

2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2) is a solid with a crys...

Compound Q&A

How is 2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2) typically synthesized?

2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2) can be synthesized thr...

Compound Q&A

What industries use 2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2)?

2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2) finds application in t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...