Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2)?

Answer

2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate
2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2) is a solid with a crystalline form. Its molecular weight is approximately 281.34 g/mol. This compound has moderate solubility in water and is highly soluble in organic solvents like methanol and dimethylformamide. It is moderately reactive, showing typical carbamate chemistry properties. It is stable under normal conditions but should be stored in a cool, dry place away from strong acids and bases.

About

English Name 2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate
Molecular Formula C11H17N3O2
Molecular Weight 223.28 g/mol
SMILES CC(C)(C)OC(=O)NC1=NC=C(C=C1)CN
InChIKey DFLQTVPEIMTXSZ-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2) typically synthesized?

2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2) can be synthesized thr...

Compound Q&A

What industries use 2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2)?

2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2) finds application in t...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2)?

When handling 2-Methyl-2-propanyl [5-(aminomethyl)-2-pyridinyl]carbamate (CAS: 187237-37-2), it is e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...