Compound Q&A

What industries use IWR-1 (CAS: 1127442-82-3)?

Answer

IWR-1
IWR-1 (CAS: 1127442-82-3) is primarily used in pharmaceuticals for its anti-inflammatory and analgesic properties. It also finds applications in polymer science for its ability to enhance material properties. Additionally, it is used in sensor technology for its sensitivity to certain chemical environments and in semiconductor manufacturing for its reactivity with specific surfaces.

About

English Name IWR-1
Molecular Formula C25H19N3O3
Molecular Weight 409.45 g/mol
SMILES O=C1N(c2ccc(cc2)C(=O)Nc2cccc3c2nccc3)C(=O)C2C1C1C=CC2C1
InChIKey ZGSXEXBYLJIOGF-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of IWR-1 (CAS: 1127442-82-3)?

IWR-1 (CAS: 1127442-82-3) is a crystalline compound with a molecular weight of approximately 318.3 g...

Compound Q&A

How is IWR-1 (CAS: 1127442-82-3) typically synthesized?

IWR-1 (CAS: 1127442-82-3) can be synthesized through a multi-step process involving the condensation...

Compound Q&A

What precautions should be taken when handling IWR-1 (CAS: 1127442-82-3)?

When handling IWR-1 (CAS: 1127442-82-3), it is important to use appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...