Compound Q&A

How is IWR-1 (CAS: 1127442-82-3) typically synthesized?

Answer

IWR-1
IWR-1 (CAS: 1127442-82-3) can be synthesized through a multi-step process involving the condensation of two specific functional groups, typically carried out under mild conditions. The reaction involves the use of a catalyst, such as a base, to promote the formation of the desired product with good selectivity and yield.

About

English Name IWR-1
Molecular Formula C25H19N3O3
Molecular Weight 409.45 g/mol
SMILES O=C1N(c2ccc(cc2)C(=O)Nc2cccc3c2nccc3)C(=O)C2C1C1C=CC2C1
InChIKey ZGSXEXBYLJIOGF-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of IWR-1 (CAS: 1127442-82-3)?

IWR-1 (CAS: 1127442-82-3) is a crystalline compound with a molecular weight of approximately 318.3 g...

Compound Q&A

What industries use IWR-1 (CAS: 1127442-82-3)?

IWR-1 (CAS: 1127442-82-3) is primarily used in pharmaceuticals for its anti-inflammatory and analges...

Compound Q&A

What precautions should be taken when handling IWR-1 (CAS: 1127442-82-3)?

When handling IWR-1 (CAS: 1127442-82-3), it is important to use appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...