Compound Q&A

What are the physical and chemical properties of IWR-1 (CAS: 1127442-82-3)?

Answer

IWR-1
IWR-1 (CAS: 1127442-82-3) is a crystalline compound with a molecular weight of approximately 318.3 g/mol. It is slightly soluble in water and organic solvents. Chemically, it is known for its stability in the absence of strong oxidizing or reducing agents. Its reactivity is moderate, showing limited reactivity with common functional groups.

About

English Name IWR-1
Molecular Formula C25H19N3O3
Molecular Weight 409.45 g/mol
SMILES O=C1N(c2ccc(cc2)C(=O)Nc2cccc3c2nccc3)C(=O)C2C1C1C=CC2C1
InChIKey ZGSXEXBYLJIOGF-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is IWR-1 (CAS: 1127442-82-3) typically synthesized?

IWR-1 (CAS: 1127442-82-3) can be synthesized through a multi-step process involving the condensation...

Compound Q&A

What industries use IWR-1 (CAS: 1127442-82-3)?

IWR-1 (CAS: 1127442-82-3) is primarily used in pharmaceuticals for its anti-inflammatory and analges...

Compound Q&A

What precautions should be taken when handling IWR-1 (CAS: 1127442-82-3)?

When handling IWR-1 (CAS: 1127442-82-3), it is important to use appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...