Compound Q&A

What industries use tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate (CAS: 898271-20-0)?

Answer

tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate
tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate is used in the pharmaceutical industry for its amino functionality, which can be used in the synthesis of drugs. It also finds applications in the polymer industry as a precursor for functionalized polymers. Additionally, it is utilized in the production of sensors and semiconductors due to its chemical reactivity and structural properties.

About

English Name tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate
Molecular Formula C10H20N2O2
Molecular Weight 200.28 g/mol
SMILES CC(C)(C)OC(=O)N1CC(C1)CCN
InChIKey XQNQFOKZUQWWDO-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate (CAS: 898271-20-0)?

tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate is a solid crystalline compound with a molecular...

Compound Q&A

How is tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate (CAS: 898271-20-0) typically synthesized?

tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate is typically synthesized through a multi-step pr...

Compound Q&A

What precautions should be taken when handling tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate (CAS: 898271-20-0)?

When handling tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate, it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...