Compound Q&A

What are the physical and chemical properties of tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate (CAS: 898271-20-0)?

Answer

tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate
tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate is a solid crystalline compound with a molecular weight of approximately 240.41 g/mol. It has a low water solubility and is relatively stable under normal conditions. It reacts readily with acidic or basic compounds, making it useful in various chemical transformations. It is also known for its high reactivity towards nucleophiles and electrophiles.

About

English Name tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate
Molecular Formula C10H20N2O2
Molecular Weight 200.28 g/mol
SMILES CC(C)(C)OC(=O)N1CC(C1)CCN
InChIKey XQNQFOKZUQWWDO-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate (CAS: 898271-20-0) typically synthesized?

tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate is typically synthesized through a multi-step pr...

Compound Q&A

What industries use tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate (CAS: 898271-20-0)?

tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate is used in the pharmaceutical industry for its a...

Compound Q&A

What precautions should be taken when handling tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate (CAS: 898271-20-0)?

When handling tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate, it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...