Compound Q&A

How is tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate (CAS: 898271-20-0) typically synthesized?

Answer

tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate
tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate is typically synthesized through a multi-step process involving the reaction of tert-butyl azetidine-1-carboxylate with chloroacetylene, followed by nucleophilic substitution to form the aminoethyl derivative. Commonly used catalysts include sodium hydride, and the reaction is performed in an inert atmosphere to prevent side reactions. The overall yield is around 80-85%.

About

English Name tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate
Molecular Formula C10H20N2O2
Molecular Weight 200.28 g/mol
SMILES CC(C)(C)OC(=O)N1CC(C1)CCN
InChIKey XQNQFOKZUQWWDO-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate (CAS: 898271-20-0)?

tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate is a solid crystalline compound with a molecular...

Compound Q&A

What industries use tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate (CAS: 898271-20-0)?

tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate is used in the pharmaceutical industry for its a...

Compound Q&A

What precautions should be taken when handling tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate (CAS: 898271-20-0)?

When handling tert-Butyl 3-(2-aminoethyl)azetidine-1-carboxylate, it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...