Compound Q&A

What industries use N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2)?

Answer

N,N,N-Tripropyl-1-propanaminium hydrogen sulfate
N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2) is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also utilized in the polymer industry for modifying polymers and in the semiconductor industry for use in cleaning and etching processes. Additionally, it finds application in sensor technology and as a reagent in analytical chemistry.

About

CAS No 56211-70-2
English Name N,N,N-Tripropyl-1-propanaminium hydrogen sulfate
Molecular Formula C12H29NO4S
Molecular Weight 283.43 g/mol
SMILES CCC[N+](CCC)(CCC)CCC.OS(=O)(=O)[O-]
InChIKey MOXJKKOSZCHGEU-UHFFFAOYSA-M
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2)?

N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2) is a crystalline compound with a ...

Compound Q&A

How is N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2) typically synthesized?

N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2) is typically synthesized via a re...

Compound Q&A

What precautions should be taken when handling N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2)?

When handling N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2), it is crucial to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...