Compound Q&A

How is N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2) typically synthesized?

Answer

N,N,N-Tripropyl-1-propanaminium hydrogen sulfate
N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2) is typically synthesized via a reaction between tripropylamine and sulfuric acid. The reaction involves heating the mixture under anhydrous conditions, followed by crystallization. Commonly used solvents include acetonitrile or dimethylformamide. The yield is usually around 85-90%, with good selectivity and reactivity.

About

CAS No 56211-70-2
English Name N,N,N-Tripropyl-1-propanaminium hydrogen sulfate
Molecular Formula C12H29NO4S
Molecular Weight 283.43 g/mol
SMILES CCC[N+](CCC)(CCC)CCC.OS(=O)(=O)[O-]
InChIKey MOXJKKOSZCHGEU-UHFFFAOYSA-M
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2)?

N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2) is a crystalline compound with a ...

Compound Q&A

What industries use N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2)?

N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2) is used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2)?

When handling N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2), it is crucial to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...