Compound Q&A

What are the physical and chemical properties of N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2)?

Answer

N,N,N-Tripropyl-1-propanaminium hydrogen sulfate
N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2) is a crystalline compound with a molecular weight of approximately 252.4 g/mol. It has a low solubility in water but is soluble in organic solvents. The compound is relatively stable but can react with strong bases. It exists as a zwitterion in aqueous solution.

About

CAS No 56211-70-2
English Name N,N,N-Tripropyl-1-propanaminium hydrogen sulfate
Molecular Formula C12H29NO4S
Molecular Weight 283.43 g/mol
SMILES CCC[N+](CCC)(CCC)CCC.OS(=O)(=O)[O-]
InChIKey MOXJKKOSZCHGEU-UHFFFAOYSA-M
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2) typically synthesized?

N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2) is typically synthesized via a re...

Compound Q&A

What industries use N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2)?

N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2) is used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2)?

When handling N,N,N-Tripropyl-1-propanaminium hydrogen sulfate (CAS: 56211-70-2), it is crucial to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...