Compound Q&A

What industries use Dolasetron Mesylate (CAS: 115956-13-3)?

Answer

Dolasetron Mesylate
Dolasetron Mesylate (CAS: 115956-13-3) is primarily used in the pharmaceutical industry. It is an antiemetic drug used to prevent nausea and vomiting caused by chemotherapy, radiotherapy, and surgery. While it has applications in the pharmaceutical field, it is not commonly used in other industries such as polymers, sensors, or semiconductors.

About

English Name Dolasetron Mesylate
Molecular Formula C20H26N2O7S
Molecular Weight 438.5 g/mol
SMILES CS(=O)(=O)O.C1C2CC3CC(CC1N3CC2=O)OC(=O)C4=CNC5=CC=CC=C54.O
InChIKey QTFFGPOXNNGTGZ-RCSCTSIBSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dolasetron Mesylate (CAS: 115956-13-3)?

Dolasetron Mesylate (CAS: 115956-13-3) is a white to off-white crystalline powder with a molecular w...

Compound Q&A

How is Dolasetron Mesylate (CAS: 115956-13-3) typically synthesized?

Dolasetron Mesylate (CAS: 115956-13-3) is typically synthesized by the methylation of dolasetron hyd...

Compound Q&A

What precautions should be taken when handling Dolasetron Mesylate (CAS: 115956-13-3)?

When handling Dolasetron Mesylate (CAS: 115956-13-3), appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...