Compound Q&A

How is Dolasetron Mesylate (CAS: 115956-13-3) typically synthesized?

Answer

Dolasetron Mesylate
Dolasetron Mesylate (CAS: 115956-13-3) is typically synthesized by the methylation of dolasetron hydrochloride. The process involves the reaction of dolasetron hydrochloride with methylsulfonyl chloride in the presence of a base, such as triethylamine, followed by the addition of methylsulfonic acid. The resulting product is dolasetron mesylate, which is then purified through recrystallization from an appropriate solvent.

About

English Name Dolasetron Mesylate
Molecular Formula C20H26N2O7S
Molecular Weight 438.5 g/mol
SMILES CS(=O)(=O)O.C1C2CC3CC(CC1N3CC2=O)OC(=O)C4=CNC5=CC=CC=C54.O
InChIKey QTFFGPOXNNGTGZ-RCSCTSIBSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dolasetron Mesylate (CAS: 115956-13-3)?

Dolasetron Mesylate (CAS: 115956-13-3) is a white to off-white crystalline powder with a molecular w...

Compound Q&A

What industries use Dolasetron Mesylate (CAS: 115956-13-3)?

Dolasetron Mesylate (CAS: 115956-13-3) is primarily used in the pharmaceutical industry. It is an an...

Compound Q&A

What precautions should be taken when handling Dolasetron Mesylate (CAS: 115956-13-3)?

When handling Dolasetron Mesylate (CAS: 115956-13-3), appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...