Compound Q&A

What are the physical and chemical properties of Dolasetron Mesylate (CAS: 115956-13-3)?

Answer

Dolasetron Mesylate
Dolasetron Mesylate (CAS: 115956-13-3) is a white to off-white crystalline powder with a molecular weight of approximately 433.46 g/mol. It is slightly soluble in water and ethanol. Dolasetron Mesylate is moderately reactive towards bases and can undergo hydrolysis. The compound exhibits good solubility in organic solvents such as methanol and acetone. It is commonly used as a prodrug for dolasetron and is known for its antiemetic properties.

About

English Name Dolasetron Mesylate
Molecular Formula C20H26N2O7S
Molecular Weight 438.5 g/mol
SMILES CS(=O)(=O)O.C1C2CC3CC(CC1N3CC2=O)OC(=O)C4=CNC5=CC=CC=C54.O
InChIKey QTFFGPOXNNGTGZ-RCSCTSIBSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is Dolasetron Mesylate (CAS: 115956-13-3) typically synthesized?

Dolasetron Mesylate (CAS: 115956-13-3) is typically synthesized by the methylation of dolasetron hyd...

Compound Q&A

What industries use Dolasetron Mesylate (CAS: 115956-13-3)?

Dolasetron Mesylate (CAS: 115956-13-3) is primarily used in the pharmaceutical industry. It is an an...

Compound Q&A

What precautions should be taken when handling Dolasetron Mesylate (CAS: 115956-13-3)?

When handling Dolasetron Mesylate (CAS: 115956-13-3), appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...