Compound Q&A

How should waste containing Pulchinenoside B (CAS: 135247-95-9) be handled?

Answer

Pulchinenoside B
Waste containing Pulchinenoside B (CAS: 135247-95-9) should be collected in appropriate containers and stored separately. Incineration or professional waste disposal services are recommended for environmentally safe disposal. Ensure all necessary safety precautions are followed, and consult local regulations for disposal methods to prevent environmental contamination.

About

English Name Pulchinenoside B
Molecular Formula C59H96O26
Molecular Weight 1221.3779 g/mol
SMILES OCC1OC(OCC2OC(OC(=O)C34CCC(C4C4C(CC3)(C)C3(C)CCC5C(C3CC4)(C)CCC(C5(C)CO)OC3OCC(C(C3OC3OC(C)C(C(C3O)O)O)O)O)C(=C)C)C(C(C2O)O)O)C(C(C1OC1OC(C)C(C(C1O)O)O)O)O
InChIKey OUHBKBTZUPLIIA-UHFFFAOYSA-N
Last Updated: 2025-10-17 23:05

Related Q&A

Compound Q&A

What regulatory guidelines apply to Pulchinenoside B (CAS: 135247-95-9)?

Pulchinenoside B (CAS: 135247-95-9) falls under the European Union's REACH regulation, which require...

Compound Q&A

Are there alternatives to Pulchinenoside B (CAS: 135247-95-9) in synthesis?

For synthesizing similar functionalities, alternatives like isomers or analogs such as pulchinenosid...

Compound Q&A

What is the market or research trend for Pulchinenoside B (CAS: 135247-95-9)?

Pulchinenoside B (CAS: 135247-95-9) is gaining interest in research for its potential biological act...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...