Compound Q&A

What regulatory guidelines apply to Pulchinenoside B (CAS: 135247-95-9)?

Answer

Pulchinenoside B
Pulchinenoside B (CAS: 135247-95-9) falls under the European Union's REACH regulation, which requires manufacturers and importers to register chemicals. In the United States, it adheres to the EPA's TSCA (Toxic Substances Control Act) and FDA regulations for any potential pharmaceutical or food additive use. GHS (Globally Harmonized System) classification is also relevant for safety data sheets and hazard communication.

About

English Name Pulchinenoside B
Molecular Formula C59H96O26
Molecular Weight 1221.3779 g/mol
SMILES OCC1OC(OCC2OC(OC(=O)C34CCC(C4C4C(CC3)(C)C3(C)CCC5C(C3CC4)(C)CCC(C5(C)CO)OC3OCC(C(C3OC3OC(C)C(C(C3O)O)O)O)O)C(=C)C)C(C(C2O)O)O)C(C(C1OC1OC(C)C(C(C1O)O)O)O)O
InChIKey OUHBKBTZUPLIIA-UHFFFAOYSA-N
Last Updated: 2025-10-17 23:05

Related Q&A

Compound Q&A

Are there alternatives to Pulchinenoside B (CAS: 135247-95-9) in synthesis?

For synthesizing similar functionalities, alternatives like isomers or analogs such as pulchinenosid...

Compound Q&A

What is the market or research trend for Pulchinenoside B (CAS: 135247-95-9)?

Pulchinenoside B (CAS: 135247-95-9) is gaining interest in research for its potential biological act...

Compound Q&A

How should waste containing Pulchinenoside B (CAS: 135247-95-9) be handled?

Waste containing Pulchinenoside B (CAS: 135247-95-9) should be collected in appropriate containers a...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...