Compound Q&A

What is the market or research trend for Pulchinenoside B (CAS: 135247-95-9)?

Answer

Pulchinenoside B
Pulchinenoside B (CAS: 135247-95-9) is gaining interest in research for its potential biological activities, particularly in cancer and inflammation. Market trends show increasing demand from pharmaceutical and biotech industries for its evaluation in preclinical studies. Additionally, research is focusing on its extraction methods and purity standards to enhance its therapeutic potential.

About

English Name Pulchinenoside B
Molecular Formula C59H96O26
Molecular Weight 1221.3779 g/mol
SMILES OCC1OC(OCC2OC(OC(=O)C34CCC(C4C4C(CC3)(C)C3(C)CCC5C(C3CC4)(C)CCC(C5(C)CO)OC3OCC(C(C3OC3OC(C)C(C(C3O)O)O)O)O)C(=C)C)C(C(C2O)O)O)C(C(C1OC1OC(C)C(C(C1O)O)O)O)O
InChIKey OUHBKBTZUPLIIA-UHFFFAOYSA-N
Last Updated: 2025-10-17 23:05

Related Q&A

Compound Q&A

What regulatory guidelines apply to Pulchinenoside B (CAS: 135247-95-9)?

Pulchinenoside B (CAS: 135247-95-9) falls under the European Union's REACH regulation, which require...

Compound Q&A

Are there alternatives to Pulchinenoside B (CAS: 135247-95-9) in synthesis?

For synthesizing similar functionalities, alternatives like isomers or analogs such as pulchinenosid...

Compound Q&A

How should waste containing Pulchinenoside B (CAS: 135247-95-9) be handled?

Waste containing Pulchinenoside B (CAS: 135247-95-9) should be collected in appropriate containers a...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...