Compound Q&A

Are there alternatives to Pulchinenoside B (CAS: 135247-95-9) in synthesis?

Answer

Pulchinenoside B
For synthesizing similar functionalities, alternatives like isomers or analogs such as pulchinenoside A can be considered. Common reagents such as acyl chlorides or carboxylic acids can serve as substitutes, depending on the desired molecular structure. The choice of alternative reagents and starting materials depends on the specific reaction conditions and product requirements.

About

English Name Pulchinenoside B
Molecular Formula C59H96O26
Molecular Weight 1221.3779 g/mol
SMILES OCC1OC(OCC2OC(OC(=O)C34CCC(C4C4C(CC3)(C)C3(C)CCC5C(C3CC4)(C)CCC(C5(C)CO)OC3OCC(C(C3OC3OC(C)C(C(C3O)O)O)O)O)C(=C)C)C(C(C2O)O)O)C(C(C1OC1OC(C)C(C(C1O)O)O)O)O
InChIKey OUHBKBTZUPLIIA-UHFFFAOYSA-N
Last Updated: 2025-10-17 23:05

Related Q&A

Compound Q&A

What regulatory guidelines apply to Pulchinenoside B (CAS: 135247-95-9)?

Pulchinenoside B (CAS: 135247-95-9) falls under the European Union's REACH regulation, which require...

Compound Q&A

What is the market or research trend for Pulchinenoside B (CAS: 135247-95-9)?

Pulchinenoside B (CAS: 135247-95-9) is gaining interest in research for its potential biological act...

Compound Q&A

How should waste containing Pulchinenoside B (CAS: 135247-95-9) be handled?

Waste containing Pulchinenoside B (CAS: 135247-95-9) should be collected in appropriate containers a...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...