Compound Q&A

What is the market or research trend for 7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4)?

Answer

7-Amino-1,3,5-naphthalenetrisulfonic acid
The market for 7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4) is driven by its use in analytical chemistry as an acid dye and in the production of pharmaceutical intermediates. Research trends indicate an increasing focus on its applications in high-performance liquid chromatography (HPLC) and other spectroscopic techniques. The trend also includes investigations into its potential use in green chemistry processes and sustainable chemical synthesis methods.

About

CAS No 27310-25-4
English Name 7-Amino-1,3,5-naphthalenetrisulfonic acid
Molecular Formula C10H9NO9S3
Molecular Weight 383.3810000000001 g/mol
SMILES C1=C(C=C(C2=C1C(=CC(=C2)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O)N
InChIKey HKTWHHAJDJCUPC-UHFFFAOYSA-N
Last Updated: 2025-10-17 23:05

Related Q&A

Compound Q&A

What regulatory guidelines apply to 7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4)?

7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4) is regulated under the Globally Harmoniz...

Compound Q&A

Are there alternatives to 7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4) in synthesis?

Alternatives to 7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4) in synthesis include oth...

Compound Q&A

How should waste containing 7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4) be handled?

Waste containing 7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4) should be collected in ...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...