Compound Q&A

Are there alternatives to 7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4) in synthesis?

Answer

7-Amino-1,3,5-naphthalenetrisulfonic acid
Alternatives to 7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4) in synthesis include other aromatic sulfonic acids such as benzenesulfonic acid and toluenesulfonic acid. These compounds can serve as efficient acid catalysts in various organic reactions. Researchers may also explore the use of inorganic acids or other organic sulfonic acids depending on the specific application and desired reactivity.

About

CAS No 27310-25-4
English Name 7-Amino-1,3,5-naphthalenetrisulfonic acid
Molecular Formula C10H9NO9S3
Molecular Weight 383.3810000000001 g/mol
SMILES C1=C(C=C(C2=C1C(=CC(=C2)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O)N
InChIKey HKTWHHAJDJCUPC-UHFFFAOYSA-N
Last Updated: 2025-10-17 23:05

Related Q&A

Compound Q&A

What regulatory guidelines apply to 7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4)?

7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4) is regulated under the Globally Harmoniz...

Compound Q&A

What is the market or research trend for 7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4)?

The market for 7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4) is driven by its use in a...

Compound Q&A

How should waste containing 7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4) be handled?

Waste containing 7-Amino-1,3,5-naphthalenetrisulfonic acid (CAS: 27310-25-4) should be collected in ...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...