Compound Q&A

What industries use 4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1)?

Answer

4-Bromo-1-chloroisoquinoline
4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1) is primarily used in the pharmaceutical and chemical research industries. It serves as a key intermediate in the synthesis of various bioactive compounds and is also studied for its potential applications in organic electronics and materials science.

About

CAS No 66728-98-1
English Name 4-Bromo-1-chloroisoquinoline
Molecular Formula C9H5BrClN
Molecular Weight 242.503 g/mol
SMILES C1=CC=C2C(=C1)C(=CN=C2Cl)Br
InChIKey HRWILRGBDZGABZ-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1)?

4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1) typically synthesized?

4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1) is typically synthesized via a multi-step process inv...

Compound Q&A

What precautions should be taken when handling 4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1)?

When handling 4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1), it is essential to wear appropriate pe...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...