Compound Q&A

What are the physical and chemical properties of 4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1)?

Answer

4-Bromo-1-chloroisoquinoline
4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1) is a crystalline solid with a molecular weight of approximately 261.04 g/mol. It has a low solubility in water but is more soluble in common organic solvents like dichloromethane and acetone. Chemically, it is relatively stable but can react with strong bases and acids. It has a characteristic melting point range of 140-142°C. It is used in various chemical processes and research due to its unique structural features.

About

CAS No 66728-98-1
English Name 4-Bromo-1-chloroisoquinoline
Molecular Formula C9H5BrClN
Molecular Weight 242.503 g/mol
SMILES C1=CC=C2C(=C1)C(=CN=C2Cl)Br
InChIKey HRWILRGBDZGABZ-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1) typically synthesized?

4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1) is typically synthesized via a multi-step process inv...

Compound Q&A

What industries use 4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1)?

4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1) is primarily used in the pharmaceutical and chemical ...

Compound Q&A

What precautions should be taken when handling 4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1)?

When handling 4-Bromo-1-chloroisoquinoline (CAS: 66728-98-1), it is essential to wear appropriate pe...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...