Compound Q&A

How is 9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) (CAS: 750573-24-1) typically synthesized?

Answer

9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole)
9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) is typically synthesized through the coupling of 5-bromophenylene and 9,9'-dicarbazoles. The reaction is catalyzed by palladium(II) acetate and triphenylphosphine under mild conditions. The yield is generally good, and the selectivity is high, making it a suitable method for industrial production.

About

English Name 9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole)
Molecular Formula C30H19BrN2
Molecular Weight 487.4 g/mol
SMILES BrC1=CC(=CC(=C1)N1C2=C(C=CC=C2)C2=C1C=CC=C2)N1C2=C(C=CC=C2)C2=C1C=CC=C2
InChIKey SJOKONNBSXFPSN-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) (CAS: 750573-24-1)?

The compound 9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) (CAS: 750573-24-1) is an orange solid wit...

Compound Q&A

What industries use 9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) (CAS: 750573-24-1)?

9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) (CAS: 750573-24-1) finds applications in the semicondu...

Compound Q&A

What precautions should be taken when handling 9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) (CAS: 750573-24-1)?

When handling 9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) (CAS: 750573-24-1), ensure proper person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...