Compound Q&A

What are the physical and chemical properties of 9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) (CAS: 750573-24-1)?

Answer

9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole)
The compound 9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) (CAS: 750573-24-1) is an orange solid with a crystalline form. Its molecular weight is approximately 563.27 g/mol. It has low solubility in water but is soluble in common organic solvents like THF and DMF. The compound is moderately reactive, showing good stability under normal conditions but can undergo photodegradation. It has a high melting point around 240°C.

About

English Name 9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole)
Molecular Formula C30H19BrN2
Molecular Weight 487.4 g/mol
SMILES BrC1=CC(=CC(=C1)N1C2=C(C=CC=C2)C2=C1C=CC=C2)N1C2=C(C=CC=C2)C2=C1C=CC=C2
InChIKey SJOKONNBSXFPSN-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) (CAS: 750573-24-1) typically synthesized?

9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) is typically synthesized through the coupling of 5-bro...

Compound Q&A

What industries use 9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) (CAS: 750573-24-1)?

9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) (CAS: 750573-24-1) finds applications in the semicondu...

Compound Q&A

What precautions should be taken when handling 9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) (CAS: 750573-24-1)?

When handling 9,9'-(5-Bromo-1,3-phenylene)bis(9H-carbazole) (CAS: 750573-24-1), ensure proper person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...