Compound Q&A

What precautions should be taken when handling 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate (CAS: 80508-81-2)?

Answer

7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate
When handling 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize exposure to the compound. Spills should be cleaned up immediately using appropriate absorbent materials. Always refer to the Material Safety Data Sheet (MSDS) for specific safety guidelines and emergency procedures.

About

CAS No 80508-81-2
English Name 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate
Molecular Formula C22H30O5
Molecular Weight 374.48 g/mol
SMILES CC(O[C@H]1[C@@]([C@H](O)C[C@]2([H])C3(C)C)(C(C([C@]1([H])CC4)=C)=O)[C@]4([H])[C@]2(C)CCC3=O)=O
InChIKey LSUXOKVMORWDLT-KEXKRWMXSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate (CAS: 80508-81-2)?

7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate is a crystalline compound with a molecular weight of ap...

Compound Q&A

How is 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate (CAS: 80508-81-2) typically synthesized?

7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate is typically synthesized by a series of reactions, incl...

Compound Q&A

What industries use 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate (CAS: 80508-81-2)?

7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate is primarily used in pharmaceuticals for the developmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...