Compound Q&A

What are the physical and chemical properties of 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate (CAS: 80508-81-2)?

Answer

7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate
7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate is a crystalline compound with a molecular weight of approximately 436 g/mol. It is slightly soluble in common organic solvents like methanol and ethanol. The compound exhibits moderate reactivity, particularly towards nucleophilic addition and oxidation reactions. It is stable under normal conditions but should be handled with care due to its chemical reactivity.

About

CAS No 80508-81-2
English Name 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate
Molecular Formula C22H30O5
Molecular Weight 374.48 g/mol
SMILES CC(O[C@H]1[C@@]([C@H](O)C[C@]2([H])C3(C)C)(C(C([C@]1([H])CC4)=C)=O)[C@]4([H])[C@]2(C)CCC3=O)=O
InChIKey LSUXOKVMORWDLT-KEXKRWMXSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate (CAS: 80508-81-2) typically synthesized?

7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate is typically synthesized by a series of reactions, incl...

Compound Q&A

What industries use 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate (CAS: 80508-81-2)?

7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate is primarily used in pharmaceuticals for the developmen...

Compound Q&A

What precautions should be taken when handling 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate (CAS: 80508-81-2)?

When handling 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate, it is crucial to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...