Compound Q&A

What industries use 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate (CAS: 80508-81-2)?

Answer

7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate
7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate is primarily used in pharmaceuticals for the development of specialized drugs. It also has potential applications in the production of certain polymers and as a precursor in the chemical industry. Its unique chemical properties also make it suitable for use in sensor technology and semiconductor manufacturing.

About

CAS No 80508-81-2
English Name 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate
Molecular Formula C22H30O5
Molecular Weight 374.48 g/mol
SMILES CC(O[C@H]1[C@@]([C@H](O)C[C@]2([H])C3(C)C)(C(C([C@]1([H])CC4)=C)=O)[C@]4([H])[C@]2(C)CCC3=O)=O
InChIKey LSUXOKVMORWDLT-KEXKRWMXSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate (CAS: 80508-81-2)?

7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate is a crystalline compound with a molecular weight of ap...

Compound Q&A

How is 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate (CAS: 80508-81-2) typically synthesized?

7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate is typically synthesized by a series of reactions, incl...

Compound Q&A

What precautions should be taken when handling 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate (CAS: 80508-81-2)?

When handling 7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate, it is crucial to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...