Compound Q&A

What industries use (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1)?

Answer

(1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid
(1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1) is used in various industries, particularly in the pharmaceutical sector for its potential as a bioactive compound. It may also find applications in polymer science for enhancing material properties. Additionally, it could be used in the development of sensors and semiconductors due to its unique chemical structure and reactivity.

About

CAS No 65355-33-1
English Name (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid
Molecular Formula C18H32O2
Molecular Weight 280.45 g/mol
SMILES CCCCCC1CCC(CC1)C2CCC(CC2)C(=O)O
InChIKey VRPANQODGRNWRV-GWEOLNPGSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1)?

(1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1) is a white solid with a cr...

Compound Q&A

How is (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1) typically synthesized?

(1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1) is usually synthesized via...

Compound Q&A

What precautions should be taken when handling (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1)?

When handling (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1), it is impor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...