Compound Q&A

How is (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1) typically synthesized?

Answer

(1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid
(1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1) is usually synthesized via a multistep process involving the coupling of pentylcyclohexyl precursors with carboxylic acid derivatives. The synthesis often requires the use of a catalyst and involves careful control of reaction conditions to ensure high yield and selectivity. The exact conditions and reagents can vary depending on the specific starting materials and desired product.

About

CAS No 65355-33-1
English Name (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid
Molecular Formula C18H32O2
Molecular Weight 280.45 g/mol
SMILES CCCCCC1CCC(CC1)C2CCC(CC2)C(=O)O
InChIKey VRPANQODGRNWRV-GWEOLNPGSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1)?

(1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1) is a white solid with a cr...

Compound Q&A

What industries use (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1)?

(1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1) is used in various industr...

Compound Q&A

What precautions should be taken when handling (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1)?

When handling (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1), it is impor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...