Compound Q&A

What are the physical and chemical properties of (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1)?

Answer

(1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid
(1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1) is a white solid with a crystalline form. It has a molecular weight of approximately 302.48 g/mol and is slightly soluble in water. The compound is known for its low reactivity in common organic solvents. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight.

About

CAS No 65355-33-1
English Name (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid
Molecular Formula C18H32O2
Molecular Weight 280.45 g/mol
SMILES CCCCCC1CCC(CC1)C2CCC(CC2)C(=O)O
InChIKey VRPANQODGRNWRV-GWEOLNPGSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1) typically synthesized?

(1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1) is usually synthesized via...

Compound Q&A

What industries use (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1)?

(1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1) is used in various industr...

Compound Q&A

What precautions should be taken when handling (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1)?

When handling (1r,4r)-4'-Pentyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 65355-33-1), it is impor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...