Compound Q&A

How is 2-Methyl-2-propanyl (7R)-5-azaspiro[2.4]hept-7-ylcarbamate (CAS: 127199-44-4) typically synthesized?

Answer

2-Methyl-2-propanyl (7R)-5-azaspiro[2.4]hept-7-ylcarbamate
The compound is typically synthesized via a multistep process involving the protection of a primary amine, followed by cyclization and deprotection. Common reagents include tert-butyldimethylsilyl chloride and various bases. The synthesis involves careful control of pH and temperature to achieve high yields and selectivity.

About

English Name 2-Methyl-2-propanyl (7R)-5-azaspiro[2.4]hept-7-ylcarbamate
Molecular Formula C11H20N2O2
Molecular Weight 212.29 g/mol
SMILES CC(C)(C)OC(=O)NC1CNCC12CC2
InChIKey CGEBPOMWRHSMLI-QMMMGPOBSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (7R)-5-azaspiro[2.4]hept-7-ylcarbamate (CAS: 127199-44-4)?

The compound is an oily liquid at room temperature with a molecular weight of approximately 212.3 g/...

Compound Q&A

What industries use 2-Methyl-2-proanyl (7R)-5-azaspiro[2.4]hept-7-ylcarbamate (CAS: 127199-44-4)?

This compound is primarily used in pharmaceutical research as a scaffolding molecule for drug discov...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl (7R)-5-azaspiro[2.4]hept-7-ylcarbamate (CAS: 127199-44-4)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...