Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (7R)-5-azaspiro[2.4]hept-7-ylcarbamate (CAS: 127199-44-4)?

Answer

2-Methyl-2-propanyl (7R)-5-azaspiro[2.4]hept-7-ylcarbamate
The compound is an oily liquid at room temperature with a molecular weight of approximately 212.3 g/mol. It has a low water solubility and moderate solubility in organic solvents. It is relatively stable under normal conditions but can react with strong bases. Chemical properties include its ability to form salts and its reactivity in nucleophilic substitution reactions.

About

English Name 2-Methyl-2-propanyl (7R)-5-azaspiro[2.4]hept-7-ylcarbamate
Molecular Formula C11H20N2O2
Molecular Weight 212.29 g/mol
SMILES CC(C)(C)OC(=O)NC1CNCC12CC2
InChIKey CGEBPOMWRHSMLI-QMMMGPOBSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (7R)-5-azaspiro[2.4]hept-7-ylcarbamate (CAS: 127199-44-4) typically synthesized?

The compound is typically synthesized via a multistep process involving the protection of a primary ...

Compound Q&A

What industries use 2-Methyl-2-proanyl (7R)-5-azaspiro[2.4]hept-7-ylcarbamate (CAS: 127199-44-4)?

This compound is primarily used in pharmaceutical research as a scaffolding molecule for drug discov...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl (7R)-5-azaspiro[2.4]hept-7-ylcarbamate (CAS: 127199-44-4)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...