Compound Q&A

What industries use 2-amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9)?

Answer

2-amino-3-(4-nitrophenyl)propanoic acid
2-Amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9) is used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the production of sensors and in some polymer formulations for its specific functional groups. However, its specific applications are limited due to its chemical reactivity.

About

CAS No 2922-40-9
English Name 2-amino-3-(4-nitrophenyl)propanoic acid
Molecular Formula C9H10N2O4
Molecular Weight 210.19 g/mol
SMILES C1=CC(=CC=C1CC(C(=O)O)N)[N+](=O)[O-]
InChIKey GTVVZTAFGPQSPC-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9)?

2-Amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9) is a crystalline solid with a molecular wei...

Compound Q&A

How is 2-amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9) typically synthesized?

2-Amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9) is commonly synthesized via the coupling of...

Compound Q&A

What precautions should be taken when handling 2-amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9)?

When handling 2-amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9), it is essential to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...