Compound Q&A

What are the physical and chemical properties of 2-amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9)?

Answer

2-amino-3-(4-nitrophenyl)propanoic acid
2-Amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9) is a crystalline solid with a molecular weight of approximately 225.11 g/mol. It has a pKa of around 4.2 and is slightly soluble in water. This compound is reactive towards nucleophiles and can undergo substitution reactions. It has a low vapor pressure and is stable under normal conditions.

About

CAS No 2922-40-9
English Name 2-amino-3-(4-nitrophenyl)propanoic acid
Molecular Formula C9H10N2O4
Molecular Weight 210.19 g/mol
SMILES C1=CC(=CC=C1CC(C(=O)O)N)[N+](=O)[O-]
InChIKey GTVVZTAFGPQSPC-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 2-amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9) typically synthesized?

2-Amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9) is commonly synthesized via the coupling of...

Compound Q&A

What industries use 2-amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9)?

2-Amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9) is used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling 2-amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9)?

When handling 2-amino-3-(4-nitrophenyl)propanoic acid (CAS: 2922-40-9), it is essential to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...