Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (3S)-3-(aminomethyl)-1-pyrrolidinecarboxylate (CAS: 199175-10-5)?

Answer

2-Methyl-2-propanyl (3S)-3-(aminomethyl)-1-pyrrolidinecarboxylate
When handling 2-Methyl-2-propanyl (3S)-3-(aminomethyl)-1-pyrrolidinecarboxylate, it is essential to use appropriate personal protective equipment (PPE) such as gloves and eye protection. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbents. Always consult the Safety Data Sheet (SDS) for specific handling and storage instructions to ensure safety in the laboratory environment.

About

English Name 2-Methyl-2-propanyl (3S)-3-(aminomethyl)-1-pyrrolidinecarboxylate
Molecular Formula C10H20N2O2
Molecular Weight 200.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)CN
InChIKey OGCCBDIYOAFOGK-QMMMGPOBSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3S)-3-(aminomethyl)-1-pyrrolidinecarboxylate (CAS: 199175-10-5)?

2-Methyl-2-propanyl (3S)-3-(aminomethyl)-1-pyrrolidinecarboxylate is a colorless to white solid with...

Compound Q&A

How is 2-Methyl-2-propanyl (3S)-3-(aminomethyl)-1-pyrrolidinecarboxylate (CAS: 199175-10-5) typically synthesized?

2-Methyl-2-propanyl (3S)-3-(aminomethyl)-1-pyrrolidinecarboxylate is synthesized through a multi-ste...

Compound Q&A

What industries use 2-Methyl-2-propanyl (3S)-3-(aminomethyl)-1-pyrrolidinecarboxylate (CAS: 199175-10-5)?

2-Methyl-2-propanyl (3S)-3-(aminomethyl)-1-pyrrolidinecarboxylate is primarily used in the pharmaceu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...