Compound Q&A

What precautions should be taken when handling Fendizoic acid (CAS: 84627-04-3)?

Answer

Fendizoic acid
When handling Fendizoic acid (CAS: 84627-04-3), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood. Spills should be carefully cleaned up using appropriate absorbents, and proper disposal procedures should be followed. Always refer to the Safety Data Sheet (SDS) for detailed guidelines.

About

CAS No 84627-04-3
English Name Fendizoic acid
Molecular Formula C20H14O4
Molecular Weight 318.33 g/mol
SMILES C1=CC=C(C=C1)C2=C(C=CC(=C2)C(=O)C3=CC=CC=C3C(=O)O)O
InChIKey PKHPZNKXOBWFCX-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fendizoic acid (CAS: 84627-04-3)?

Fendizoic acid (CAS: 84627-04-3) is a crystalline solid with a molecular weight of approximately 182...

Compound Q&A

How is Fendizoic acid (CAS: 84627-04-3) typically synthesized?

Fendizoic acid (CAS: 84627-04-3) can be synthesized through the oxidation of corresponding alcohol d...

Compound Q&A

What industries use Fendizoic acid (CAS: 84627-04-3)?

Fendizoic acid (CAS: 84627-04-3) finds application in various industries. It is used in the pharmace...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...