Compound Q&A

How is Fendizoic acid (CAS: 84627-04-3) typically synthesized?

Answer

Fendizoic acid
Fendizoic acid (CAS: 84627-04-3) can be synthesized through the oxidation of corresponding alcohol derivatives. Common methods include the use of peroxyacids or chromium(VI) compounds as oxidants. The reaction is typically conducted in aqueous media under controlled conditions to ensure high selectivity and yield.

About

CAS No 84627-04-3
English Name Fendizoic acid
Molecular Formula C20H14O4
Molecular Weight 318.33 g/mol
SMILES C1=CC=C(C=C1)C2=C(C=CC(=C2)C(=O)C3=CC=CC=C3C(=O)O)O
InChIKey PKHPZNKXOBWFCX-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fendizoic acid (CAS: 84627-04-3)?

Fendizoic acid (CAS: 84627-04-3) is a crystalline solid with a molecular weight of approximately 182...

Compound Q&A

What industries use Fendizoic acid (CAS: 84627-04-3)?

Fendizoic acid (CAS: 84627-04-3) finds application in various industries. It is used in the pharmace...

Compound Q&A

What precautions should be taken when handling Fendizoic acid (CAS: 84627-04-3)?

When handling Fendizoic acid (CAS: 84627-04-3), it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...