Compound Q&A

What are the physical and chemical properties of Fendizoic acid (CAS: 84627-04-3)?

Answer

Fendizoic acid
Fendizoic acid (CAS: 84627-04-3) is a crystalline solid with a molecular weight of approximately 182.14 g/mol. It is poorly soluble in water but miscible with many organic solvents. Chemically, it exhibits reactivity typical of carboxylic acids, including the formation of esters and anhydrides. It also displays acidity, with a pKa value of around 4.8.

About

CAS No 84627-04-3
English Name Fendizoic acid
Molecular Formula C20H14O4
Molecular Weight 318.33 g/mol
SMILES C1=CC=C(C=C1)C2=C(C=CC(=C2)C(=O)C3=CC=CC=C3C(=O)O)O
InChIKey PKHPZNKXOBWFCX-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is Fendizoic acid (CAS: 84627-04-3) typically synthesized?

Fendizoic acid (CAS: 84627-04-3) can be synthesized through the oxidation of corresponding alcohol d...

Compound Q&A

What industries use Fendizoic acid (CAS: 84627-04-3)?

Fendizoic acid (CAS: 84627-04-3) finds application in various industries. It is used in the pharmace...

Compound Q&A

What precautions should be taken when handling Fendizoic acid (CAS: 84627-04-3)?

When handling Fendizoic acid (CAS: 84627-04-3), it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...