Compound Q&A

What industries use 5(6)-TAMRA SE (CAS: 246256-50-8)?

Answer

5(6)-TAMRA SE
5(6)-TAMRA SE is extensively used in various industries, including pharmaceuticals for drug screening and diagnostic applications, polymer science for labeling and tracking, sensing technologies for detecting specific analytes, and semiconductor industries for quality control and process monitoring. Its fluorescence properties make it particularly valuable in these fields.

About

English Name 5(6)-TAMRA SE
Molecular Formula C58H50N6O14
Molecular Weight 1055.05 g/mol
SMILES O=C1CCC(=O)N1OC(=O)c1ccc2c(c1)C1(OC2=O)c2ccc(cc2Oc2c1ccc(c2)N(C)C)N(C)C.O=C1CCC(=O)N1OC(=O)c1ccc2c(c1)C(=O)OC12c2ccc(cc2Oc2c1ccc(c2)N(C)C)N(C)C
InChIKey UWQYEQKHQZYMMZ-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5(6)-TAMRA SE (CAS: 246256-50-8)?

5(6)-TAMRA SE is a fluorescent dye with a molecular weight of approximately 637.6 g/mol. It exhibits...

Compound Q&A

How is 5(6)-TAMRA SE (CAS: 246256-50-8) typically synthesized?

5(6)-TAMRA SE is typically synthesized by coupling a 5-carboxytetramethylrhodamine (TAMRA) dye to a ...

Compound Q&A

What precautions should be taken when handling 5(6)-TAMRA SE (CAS: 246256-50-8)?

When handling 5(6)-TAMRA SE, appropriate personal protective equipment (PPE) is essential, including...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...