Compound Q&A

What are the physical and chemical properties of 5(6)-TAMRA SE (CAS: 246256-50-8)?

Answer

5(6)-TAMRA SE
5(6)-TAMRA SE is a fluorescent dye with a molecular weight of approximately 637.6 g/mol. It exhibits excellent solubility in organic solvents such as DMSO and ethanol. Chemically, it shows high stability under basic conditions but is less stable in acidic environments. It is widely used in fluorescence labeling due to its strong red fluorescence and good photostability.

About

English Name 5(6)-TAMRA SE
Molecular Formula C58H50N6O14
Molecular Weight 1055.05 g/mol
SMILES O=C1CCC(=O)N1OC(=O)c1ccc2c(c1)C1(OC2=O)c2ccc(cc2Oc2c1ccc(c2)N(C)C)N(C)C.O=C1CCC(=O)N1OC(=O)c1ccc2c(c1)C(=O)OC12c2ccc(cc2Oc2c1ccc(c2)N(C)C)N(C)C
InChIKey UWQYEQKHQZYMMZ-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 5(6)-TAMRA SE (CAS: 246256-50-8) typically synthesized?

5(6)-TAMRA SE is typically synthesized by coupling a 5-carboxytetramethylrhodamine (TAMRA) dye to a ...

Compound Q&A

What industries use 5(6)-TAMRA SE (CAS: 246256-50-8)?

5(6)-TAMRA SE is extensively used in various industries, including pharmaceuticals for drug screenin...

Compound Q&A

What precautions should be taken when handling 5(6)-TAMRA SE (CAS: 246256-50-8)?

When handling 5(6)-TAMRA SE, appropriate personal protective equipment (PPE) is essential, including...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...