Compound Q&A

What precautions should be taken when handling 2-Fluoro-5-(trifluoromethoxy)benzoic acid (CAS: 886497-85-4)?

Answer

2-Fluoro-5-(trifluoromethoxy)benzoic acid
When handling 2-Fluoro-5-(trifluoromethoxy)benzoic acid, it is essential to wear appropriate personal protective equipment (PPE), such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate absorbents, and the area should be well-ventilated. Always consult the Safety Data Sheet (SDS) for specific handling and disposal recommendations.

About

English Name 2-Fluoro-5-(trifluoromethoxy)benzoic acid
Molecular Formula C8H4F4O3
Molecular Weight 224.11 g/mol
SMILES C1=CC(=C(C=C1OC(F)(F)F)C(=O)O)F
InChIKey CSMVUVGPLMTFIZ-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-5-(trifluoromethoxy)benzoic acid (CAS: 886497-85-4)?

2-Fluoro-5-(trifluoromethoxy)benzoic acid is a crystalline solid with a high molecular weight. It ha...

Compound Q&A

How is 2-Fluoro-5-(trifluoromethoxy)benzoic acid (CAS: 886497-85-4) typically synthesized?

2-Fluoro-5-(trifluoromethoxy)benzoic acid can be synthesized through a Fries rearrangement of 5-(tri...

Compound Q&A

What industries use 2-Fluoro-5-(trifluoromethoxy)benzoic acid (CAS: 886497-85-4)?

2-Fluoro-5-(trifluoromethoxy)benzoic acid is used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...