Compound Q&A

What industries use 2-Fluoro-5-(trifluoromethoxy)benzoic acid (CAS: 886497-85-4)?

Answer

2-Fluoro-5-(trifluoromethoxy)benzoic acid
2-Fluoro-5-(trifluoromethoxy)benzoic acid is used in the pharmaceutical industry for the synthesis of medicinally active compounds. It is also applied in the polymer industry for the development of specialty polymers, and in the semiconductor industry for the fabrication of electronic materials. Additionally, it has potential applications in sensor technology.

About

English Name 2-Fluoro-5-(trifluoromethoxy)benzoic acid
Molecular Formula C8H4F4O3
Molecular Weight 224.11 g/mol
SMILES C1=CC(=C(C=C1OC(F)(F)F)C(=O)O)F
InChIKey CSMVUVGPLMTFIZ-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-5-(trifluoromethoxy)benzoic acid (CAS: 886497-85-4)?

2-Fluoro-5-(trifluoromethoxy)benzoic acid is a crystalline solid with a high molecular weight. It ha...

Compound Q&A

How is 2-Fluoro-5-(trifluoromethoxy)benzoic acid (CAS: 886497-85-4) typically synthesized?

2-Fluoro-5-(trifluoromethoxy)benzoic acid can be synthesized through a Fries rearrangement of 5-(tri...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-5-(trifluoromethoxy)benzoic acid (CAS: 886497-85-4)?

When handling 2-Fluoro-5-(trifluoromethoxy)benzoic acid, it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...