Compound Q&A

How is 2-Fluoro-5-(trifluoromethoxy)benzoic acid (CAS: 886497-85-4) typically synthesized?

Answer

2-Fluoro-5-(trifluoromethoxy)benzoic acid
2-Fluoro-5-(trifluoromethoxy)benzoic acid can be synthesized through a Fries rearrangement of 5-(trifluoromethoxy)benzyl trifluoromethanesulfonate with fluoroacetic anhydride. The process involves the use of a Lewis acid catalyst, such as aluminum trichloride, to promote the rearrangement. The yield is typically around 60-70%, and the method is selective for the desired product.

About

English Name 2-Fluoro-5-(trifluoromethoxy)benzoic acid
Molecular Formula C8H4F4O3
Molecular Weight 224.10899999999995 g/mol
SMILES C1=CC(=C(C=C1OC(F)(F)F)C(=O)O)F
InChIKey CSMVUVGPLMTFIZ-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-5-(trifluoromethoxy)benzoic acid (CAS: 886497-85-4)?

2-Fluoro-5-(trifluoromethoxy)benzoic acid is a crystalline solid with a high molecular weight. It ha...

Compound Q&A

What industries use 2-Fluoro-5-(trifluoromethoxy)benzoic acid (CAS: 886497-85-4)?

2-Fluoro-5-(trifluoromethoxy)benzoic acid is used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-5-(trifluoromethoxy)benzoic acid (CAS: 886497-85-4)?

When handling 2-Fluoro-5-(trifluoromethoxy)benzoic acid, it is essential to wear appropriate persona...

Compound Q&A

What industries use (1R,3S)-1,3-Cyclopentanediol (CAS: 16326-97-9)?

(1R,3S)-1,3-Cyclopentanediol finds applications in various industries. In the ph...

16326-97-9(1R,3S)-1,3-Cyclopen...
Compound Q&A

What precautions should be taken when handling N'-[4-(Dimethylamino)phenyl]-N,N-dimethyl-1,4-benzenediamine (CAS: 637-31-0)?

When handling N'-[4-(Dimethylamino)phenyl]-N,N-dimethyl-1,4-benzenediamine, it i...

637-31-0N'-[4-(Dimethylamino...
Compound Q&A

Are there alternatives to 5-(2,4-Difluorophenyl)-2-methoxypyrimidine (CAS: 1352318-16-1) in synthesis?

There are several alternatives to 5-(2,4-Difluorophenyl)-2-methoxypyrimidine in ...

1352318-16-15-(2,4-Difluoropheny...
Compound Q&A

What regulatory guidelines apply to 1-(3-Methoxyphenoxy)propan-2-ol (CAS: 382141-68-6)?

1-(3-Methoxyphenoxy)propan-2-ol (CAS: 382141-68-6) must comply with the Globally...

382141-68-61-(3-Methoxyphenoxy)...