Compound Q&A

How is Apremilast Impurity 67 (CAS: 136285-65-9) typically synthesized?

Answer

Apremilast Impurity 67
Apremilast Impurity 67 (CAS: 136285-65-9) is typically synthesized via a multi-step process involving nucleophilic substitution and condensation reactions. The synthesis generally uses catalysts like palladium acetate to enhance selectivity and yield, achieving a high purity product.

About

English Name Apremilast Impurity 67
Molecular Formula C16H22N2O6
Molecular Weight 310.3 g/mol
SMILES CCOC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])NC(=O)OC(C)(C)C
InChIKey JFNARDWNFAOEBF-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Apremilast Impurity 67 (CAS: 136285-65-9)?

Apremilast Impurity 67 (CAS: 136285-65-9) is a white crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use Apremilast Impurity 67 (CAS: 136285-65-9)?

Apremilast Impurity 67 (CAS: 136285-65-9) is primarily used in the pharmaceutical industry, particul...

Compound Q&A

What precautions should be taken when handling Apremilast Impurity 67 (CAS: 136285-65-9)?

When handling Apremilast Impurity 67 (CAS: 136285-65-9), it is essential to use personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...