Compound Q&A

What are the physical and chemical properties of Apremilast Impurity 67 (CAS: 136285-65-9)?

Answer

Apremilast Impurity 67
Apremilast Impurity 67 (CAS: 136285-65-9) is a white crystalline solid with a molecular weight of approximately 552.67 g/mol. It is poorly soluble in water but soluble in organic solvents like methanol and acetonitrile. The compound is known for its low reactivity under normal conditions but may undergo hydrolysis under acidic or basic conditions.

About

English Name Apremilast Impurity 67
Molecular Formula C16H22N2O6
Molecular Weight 310.3 g/mol
SMILES CCOC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])NC(=O)OC(C)(C)C
InChIKey JFNARDWNFAOEBF-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is Apremilast Impurity 67 (CAS: 136285-65-9) typically synthesized?

Apremilast Impurity 67 (CAS: 136285-65-9) is typically synthesized via a multi-step process involvin...

Compound Q&A

What industries use Apremilast Impurity 67 (CAS: 136285-65-9)?

Apremilast Impurity 67 (CAS: 136285-65-9) is primarily used in the pharmaceutical industry, particul...

Compound Q&A

What precautions should be taken when handling Apremilast Impurity 67 (CAS: 136285-65-9)?

When handling Apremilast Impurity 67 (CAS: 136285-65-9), it is essential to use personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...