Compound Q&A

What industries use 1-Cbz-azetidine-3-carboxylic acid (CAS: 97628-92-7)?

Answer

1-Cbz-azetidine-3-carboxylic acid
1-Cbz-azetidine-3-carboxylic acid is used in the pharmaceutical industry for the synthesis of various biologically active compounds. It is also utilized in polymer synthesis for developing functional polymers with specific properties. Additionally, it plays a role in sensor technology and semiconductor manufacturing due to its reactivity and chemical stability.

About

CAS No 97628-92-7
English Name 1-Cbz-azetidine-3-carboxylic acid
Molecular Formula C12H13NO4
Molecular Weight 235.24 g/mol
SMILES C1C(CN1C(=O)OCC2=CC=CC=C2)C(=O)O
InChIKey PVJPBKZGIUAESY-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Cbz-azetidine-3-carboxylic acid (CAS: 97628-92-7)?

1-Cbz-azetidine-3-carboxylic acid is a white crystalline solid with a molecular weight of 249.28 g/m...

Compound Q&A

How is 1-Cbz-azetidine-3-carboxylic acid (CAS: 97628-92-7) typically synthesized?

1-Cbz-azetidine-3-carboxylic acid is often synthesized through amidification of 1-Cbz-azetidine-3-ca...

Compound Q&A

What precautions should be taken when handling 1-Cbz-azetidine-3-carboxylic acid (CAS: 97628-92-7)?

When handling 1-Cbz-azetidine-3-carboxylic acid, it is crucial to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...