Compound Q&A

How is 1-Cbz-azetidine-3-carboxylic acid (CAS: 97628-92-7) typically synthesized?

Answer

1-Cbz-azetidine-3-carboxylic acid
1-Cbz-azetidine-3-carboxylic acid is often synthesized through amidification of 1-Cbz-azetidine-3-carboxylic anhydride with appropriate bases. The reaction typically proceeds with good yield and selectivity using stoichiometric amounts of base under reflux conditions. Common catalysts include triethylamine and pyridine.

About

CAS No 97628-92-7
English Name 1-Cbz-azetidine-3-carboxylic acid
Molecular Formula C12H13NO4
Molecular Weight 235.24 g/mol
SMILES C1C(CN1C(=O)OCC2=CC=CC=C2)C(=O)O
InChIKey PVJPBKZGIUAESY-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Cbz-azetidine-3-carboxylic acid (CAS: 97628-92-7)?

1-Cbz-azetidine-3-carboxylic acid is a white crystalline solid with a molecular weight of 249.28 g/m...

Compound Q&A

What industries use 1-Cbz-azetidine-3-carboxylic acid (CAS: 97628-92-7)?

1-Cbz-azetidine-3-carboxylic acid is used in the pharmaceutical industry for the synthesis of variou...

Compound Q&A

What precautions should be taken when handling 1-Cbz-azetidine-3-carboxylic acid (CAS: 97628-92-7)?

When handling 1-Cbz-azetidine-3-carboxylic acid, it is crucial to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...