Compound Q&A

What industries use 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid (CAS: 60547-92-4)?

Answer

4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid
4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid is used in the pharmaceutical industry for the synthesis of certain drugs. It is also applicable in the polymer industry for the development of functional polymers and in the sensor industry for use in various analytical applications. Additionally, it plays a role in semiconductor technology as a precursor in chemical vapor deposition processes.

About

CAS No 60547-92-4
English Name 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid
Molecular Formula C15H13NO6
Molecular Weight 303.27 g/mol
SMILES COC1=C(C=C(C(=C1)C(=O)O)[N+](=O)[O-])OCC2=CC=CC=C2
InChIKey VTHHRADLOLKTLD-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid (CAS: 60547-92-4)?

4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid (CAS: 60547-92-4) typically synthesized?

4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid is typically synthesized via the nitration of 4-(benzylo...

Compound Q&A

What precautions should be taken when handling 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid (CAS: 60547-92-4)?

When handling 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid, it is crucial to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...