Compound Q&A

How is 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid (CAS: 60547-92-4) typically synthesized?

Answer

4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid
4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid is typically synthesized via the nitration of 4-(benzyloxy)-5-methoxybenzoic acid. This involves the use of a nitration mixture containing concentrated nitric acid and sulfuric acid. The reaction is carried out under controlled conditions to ensure high selectivity and yield, often achieved through the use of catalytic amounts of sulfuric acid as a catalyst.

About

CAS No 60547-92-4
English Name 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid
Molecular Formula C15H13NO6
Molecular Weight 303.27 g/mol
SMILES COC1=C(C=C(C(=C1)C(=O)O)[N+](=O)[O-])OCC2=CC=CC=C2
InChIKey VTHHRADLOLKTLD-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid (CAS: 60547-92-4)?

4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid is a crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid (CAS: 60547-92-4)?

4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid is used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid (CAS: 60547-92-4)?

When handling 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid, it is crucial to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...